Difference between revisions of "MAL"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14774 RXN-14774] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC(O)C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L |
+ | * common name: | ||
+ | ** (S)-malate | ||
+ | * molecular weight: | ||
+ | ** 132.073 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (S)-malic acid | ||
+ | ** L-apple acid | ||
+ | ** L-malic acid | ||
+ | ** L-hydroxysuccinic acid | ||
+ | ** L-hydroxybutanedioic acid | ||
+ | ** L-malate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[1.1.1.39-RXN]] |
− | + | * [[MALIC-NADP-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[MALATE-DEHYDROGENASE-NADP+-RXN]] | |
− | + | * [[RXN-6002]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | * [[MALATE-DEH-RXN]] | |
− | * [[ | + | * [[FUMHYDR-RXN]] |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 6915-15-7 |
− | {{#set: | + | * CAS : 97-67-6 |
− | {{#set: | + | * METABOLIGHTS : MTBLC15589 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459792 5459792] |
− | {{#set: | + | * HMDB : HMDB00156 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00149 C00149] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573566.html 4573566] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15589 15589] | ||
+ | * BIGG : mal__L | ||
+ | {{#set: smiles=C(=O)([O-])CC(O)C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L}} | ||
+ | {{#set: common name=(S)-malate}} | ||
+ | {{#set: molecular weight=132.073 }} | ||
+ | {{#set: common name=(S)-malic acid|L-apple acid|L-malic acid|L-hydroxysuccinic acid|L-hydroxybutanedioic acid|L-malate}} | ||
+ | {{#set: consumed by=1.1.1.39-RXN|MALIC-NADP-RXN}} | ||
+ | {{#set: produced by=MALATE-DEHYDROGENASE-NADP+-RXN|RXN-6002}} | ||
+ | {{#set: reversible reaction associated=MALATE-DEH-RXN|FUMHYDR-RXN}} |
Revision as of 16:51, 23 May 2018
Contents
Metabolite MAL
- smiles:
- C(=O)([O-])CC(O)C([O-])=O
- inchi key:
- InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L
- common name:
- (S)-malate
- molecular weight:
- 132.073
- Synonym(s):
- (S)-malic acid
- L-apple acid
- L-malic acid
- L-hydroxysuccinic acid
- L-hydroxybutanedioic acid
- L-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6915-15-7
- CAS : 97-67-6
- METABOLIGHTS : MTBLC15589
- PUBCHEM:
- HMDB : HMDB00156
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : mal__L
"C(=O)([O-])CC(O)C([O-])=O" cannot be used as a page name in this wiki.