Difference between revisions of "CHC T00010112001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...")
 
(Created page with "Category:Gene == Gene CHC_T00010112001_1 == * Synonym(s): == Reactions associated == * Reaction: NADH-DEHYDROG-A-RXN ** Source: orthology-ectocarpus_siliculosus *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] ==
+
== Gene CHC_T00010112001_1 ==
* smiles:
+
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
+
* inchi key:
+
** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
+
* common name:
+
** 1-oleoyl-2-lyso-glycerone phosphate
+
* molecular weight:
+
** 432.493   
+
 
* Synonym(s):
 
* Synonym(s):
** 1-oleoyl-2-lyso-dihydroxyacetone phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15046]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
* [[RXN-15044]]
+
* Reaction: [[RXN0-5330]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-4302]]
 +
* [[PWY-3781]]
 +
* [[PWY-7269]]
 +
* [[PWY-7279]]
 +
* [[PWY0-1573]]
 +
* [[PWY0-1567]]
 +
* [[PWY-6692]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1568]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|RXN0-5330}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257]
+
{{#set: pathway associated=PWY-4302|PWY-3781|PWY-7269|PWY-7279|PWY0-1573|PWY0-1567|PWY-6692|PWY0-1334|PWY0-1335|PWY-5083|PWY0-1568}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492]
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}}
+
{{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}}
+
{{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}}
+
{{#set: molecular weight=432.493    }}
+
{{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}}
+
{{#set: consumed by=RXN-15046}}
+
{{#set: produced by=RXN-15044}}
+

Revision as of 16:52, 23 May 2018

Gene CHC_T00010112001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links