Difference between revisions of "Protein-D-serines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] == * smiles: ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] == * common name: ** a [protein]-D-serine * Synonym(s): =...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] ==
* smiles:
+
** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
* inchi key:
+
** InChIKey=QHHKKMYHDBRONY-VKBDFPRVSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxybutanoyl-CoA
+
** a [protein]-D-serine
* molecular weight:
+
** 849.593   
+
 
* Synonym(s):
 
* Synonym(s):
** L-3-hydroxybutyryl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-11667]]
+
* [[5.1.1.16-RXN]]
* [[5.1.2.3-RXN]]
+
* [[RXN-11662]]
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-D-serine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266553 45266553]
+
{{#set: reversible reaction associated=5.1.1.16-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57316 57316]
+
* BIGG : 3hbcoa
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01144 C01144]
+
{{#set: smiles=CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: inchi key=InChIKey=QHHKKMYHDBRONY-VKBDFPRVSA-J}}
+
{{#set: common name=(S)-3-hydroxybutanoyl-CoA}}
+
{{#set: molecular weight=849.593    }}
+
{{#set: common name=L-3-hydroxybutyryl-CoA}}
+
{{#set: consumed or produced by=RXN-11667|5.1.2.3-RXN|RXN-11662}}
+

Latest revision as of 16:53, 23 May 2018

Metabolite Protein-D-serines

  • common name:
    • a [protein]-D-serine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-D-serine" cannot be used as a page name in this wiki.