Difference between revisions of "CHC T00008487001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O...")
 
(Created page with "Category:Gene == Gene CHC_T00008487001 == * left end position: ** 437597 * transcription direction: ** POSITIVE * right end position: ** 441484 * centisome position: ** 42...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] ==
+
== Gene CHC_T00008487001 ==
* smiles:
+
* left end position:
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 437597
* inchi key:
+
* transcription direction:
** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L
+
** POSITIVE
* common name:
+
* right end position:
** (3Z)-phytochromobilin
+
** 441484
* molecular weight:
+
* centisome position:
** 582.655    
+
** 42.667664    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
* [[1.3.7.4-RXN]]
+
** Source: [[annotation-original_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-4041]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=437597}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: right end position=441484}}
{{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}}
+
{{#set: centisome position=42.667664    }}
{{#set: common name=(3Z)-phytochromobilin}}
+
{{#set: reaction associated=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}}
{{#set: molecular weight=582.655    }}
+
{{#set: pathway associated=PWY-4041}}
{{#set: produced by=1.3.7.4-RXN}}
+

Latest revision as of 16:55, 23 May 2018

Gene CHC_T00008487001

  • left end position:
    • 437597
  • transcription direction:
    • POSITIVE
  • right end position:
    • 441484
  • centisome position:
    • 42.667664
  • Synonym(s):

Reactions associated

Pathways associated

External links