|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.16-RXN 3.1.3.16-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.1.3.16 EC-3.1.3.16] | + | ** InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N |
| + | * common name: |
| + | ** thiamine |
| + | * molecular weight: |
| + | ** 265.352 |
| * Synonym(s): | | * Synonym(s): |
| + | ** thiamin |
| + | ** vitamin B1 |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers: | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
− | ** 1 [[Protein-Ser-or-Thr-phosphate]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Protein-L-serine-or-L-threonine]][c]
| + | * [[TransportSeed_THIAMINE]] |
− | * With common name(s): | + | == Reaction(s) known to produce the compound == |
− | ** 1 a [protein] (L-serine/L-threonine) phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 a [protein]-(L-serine/L-threonine)[c]
| + | * [[TransportSeed_THIAMINE]] |
− | | + | == Reaction(s) of unknown directionality == |
− | == Genes associated with this reaction == | + | * [[ExchangeSeed_THIAMINE]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00009328001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00007021001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00006835001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008508001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00006477001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00002485001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00004777001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008536001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008630001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00009030001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00000279001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00006530001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00004449001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * CAS : 67-03-8 |
− | ** [http://www.uniprot.org/uniprot/P67776 P67776] | + | * CAS : 59-43-8 |
− | ** [http://www.uniprot.org/uniprot/P67774 P67774] | + | * METABOLIGHTS : MTBLC18385 |
− | ** [http://www.uniprot.org/uniprot/P63328 P63328] | + | * DRUGBANK : DB00152 |
− | ** [http://www.uniprot.org/uniprot/P20650 P20650] | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P20654 P20654] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1130 1130] |
− | ** [http://www.uniprot.org/uniprot/P13681 P13681]
| + | * HMDB : HMDB00235 |
− | ** [http://www.uniprot.org/uniprot/P63329 P63329]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P20651 P20651] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00378 C00378] |
− | ** [http://www.uniprot.org/uniprot/Q7M2R6 Q7M2R6] | + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P23635 P23635] | + | ** [http://www.chemspider.com/Chemical-Structure.1098.html 1098] |
− | ** [http://www.uniprot.org/uniprot/P16298 P16298] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q04071 Q04071] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18385 18385] |
− | ** [http://www.uniprot.org/uniprot/P48455 P48455]
| + | * BIGG : thm |
− | ** [http://www.uniprot.org/uniprot/Q7M2L6 Q7M2L6] | + | {{#set: smiles=CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))}} |
− | ** [http://www.uniprot.org/uniprot/Q00756 Q00756] | + | {{#set: inchi key=InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q05681 Q05681]
| + | {{#set: common name=thiamine}} |
− | ** [http://www.uniprot.org/uniprot/P36876 P36876]
| + | {{#set: molecular weight=265.352 }} |
− | ** [http://www.uniprot.org/uniprot/P40421 P40421] | + | {{#set: common name=thiamin|vitamin B1}} |
− | ** [http://www.uniprot.org/uniprot/Q27787 Q27787]
| + | {{#set: consumed by=THIAMIN-PYROPHOSPHOKINASE-RXN|TransportSeed_THIAMINE}} |
− | ** [http://www.uniprot.org/uniprot/P36872 P36872]
| + | {{#set: produced by=TransportSeed_THIAMINE}} |
− | ** [http://www.uniprot.org/uniprot/Q07161 Q07161]
| + | {{#set: reversible reaction associated=ExchangeSeed_THIAMINE}} |
− | ** [http://www.uniprot.org/uniprot/Q06190 Q06190]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36982 P36982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49444 P49444]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50410 P50410]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40371 P40371]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48452 P48452]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23880 P23880]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23636 P23636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48456 P48456]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27786 Q27786]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63087 P63087]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04104 Q04104]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62141 P62141]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54613 P54613]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04101 Q04101]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28453 O28453]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04102 Q04102]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04103 Q04103]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16821 Q16821]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36993 P36993]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16474 Q16474]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62142 P62142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63088 P63088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48454 P48454]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35815 P35815]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92140 Q92140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P87345 P87345]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9P982 Q9P982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48453 P48453]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62138 P62138]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20604 P20604]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26570 P26570]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23594 P23594]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23595 P23595]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32345 P32345]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12982 P12982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11612 P11612]
| + | |
− | ** [http://www.uniprot.org/uniprot/P67777 P67777]
| + | |
− | ** [http://www.uniprot.org/uniprot/P67775 P67775]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62714 P62714]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62139 P62139]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11611 P11611]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11084 P11084]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63331 P63331]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62716 P62716]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23734 P23734]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23696 P23696]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23777 P23777]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48461 P48461]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48462 P48462]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62143 P62143]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23287 P23287]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8AVH9 Q8AVH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35814 P35814]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35813 P35813]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48482 P48482]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48485 P48485]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48487 P48487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PSQ6 Q9PSQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q95097 Q95097]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22198 P22198]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05547 Q05547]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48483 P48483]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48484 P48484]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07099 Q07099]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07098 Q07098]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07100 Q07100]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32598 P32598]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36877 P36877]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08209 Q08209]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06009 Q06009]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33329 P33329]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36873 P36873]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31383 P31383]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48579 P48579]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32945 P32945]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27884 Q27884]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34221 P34221]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E4 Q7M3E4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P62140 P62140]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27889 Q27889]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35182 P35182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48529 P48529]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48528 P48528]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q21513 Q21513]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48488 P48488]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48457 P48457]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38089 P38089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14747 P14747]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48490 P48490]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53041 P53041]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53043 P53043]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48578 P48578]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49598 P49598]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48580 P48580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32838 P32838]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q63759 Q63759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q14738 Q14738]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27560 Q27560]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q38845 Q38845]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8L7U5 Q8L7U5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48489 P48489]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42981 Q42981]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04856 O04856]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04857 O04857]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04858 O04858]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04859 O04859]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04860 O04860]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40556 Q40556]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49597 P49597]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65844 O65844]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65845 O65845]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65846 O65846]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65847 O65847]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81955 O81955]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81956 O81956]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q50188 Q50188]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48486 P48486]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42912 Q42912]
| + | |
− | ** [http://www.uniprot.org/uniprot/O18148 O18148]
| + | |
− | ** [http://www.uniprot.org/uniprot/O14189 O14189]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10298 Q10298]
| + | |
− | ** [http://www.uniprot.org/uniprot/O01921 O01921]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q94374 Q94374]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q94372 Q94372]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q94371 Q94371]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q94370 Q94370]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12705 Q12705]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49346 O49346]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82469 O82469]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: ec number=EC-3.1.3.16}} | + | |
− | {{#set: gene associated=CHC_T00009328001_1|CHC_T00007021001_1|CHC_T00006835001_1|CHC_T00008508001_1|CHC_T00006477001_1|CHC_T00002485001_1|CHC_T00004777001_1|CHC_T00008536001_1|CHC_T00008630001_1|CHC_T00009030001_1|CHC_T00000279001_1|CHC_T00006530001_1|CHC_T00004449001_1}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}} | + | |