Difference between revisions of "RXN-14354"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * smiles: ** C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14354 RXN-14354] == * direction: ** LEFT-TO-RIGHT * common name: ** Disproportionating Enzyme t...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14354 RXN-14354] ==
−
* smiles:
+
* direction:
−
** C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L
+
 
* common name:
 
* common name:
−
** ADP-α-D-glucose
+
** Disproportionating Enzyme type 2
−
* molecular weight:
+
* ec number:
−
** 587.33   
+
** [http://enzyme.expasy.org/EC/2.4.1.25 EC-2.4.1.25]
 
* Synonym(s):
 
* Synonym(s):
−
** adenosine diphosphate glucose
 
−
** ADP-glucose
 
−
** ADP-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14378]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Soluble-Heteroglycans]][c] '''+''' 1 [[MALTOSE]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[Soluble-Heteroglycans]][c]
−
* [[GLUC1PADENYLTRANS-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a plant soluble heteroglycan[c] '''+''' 1 maltose[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 a plant soluble heteroglycan[c]
−
* [[GLYCOGENSYN-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009120001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00009120001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2140-58-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57498
+
{{#set: common name=Disproportionating Enzyme type 2}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.4.1.25}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42609821 42609821]
+
{{#set: gene associated=CHC_T00009120001|CHC_T00009120001_1}}
−
* HMDB : HMDB06557
+
{{#set: in pathway=PWY-7238}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00498 C00498]
+
{{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57498 57498]
+
−
* BIGG : adpglc
+
−
{{#set: smiles=C(C1(C(C(C(C(O1)OP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))(=O)[O-])(=O)[O-])O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L}}
+
−
{{#set: common name=ADP-α-D-glucose}}
+
−
{{#set: molecular weight=587.33    }}
+
−
{{#set: common name=adenosine diphosphate glucose|ADP-glucose|ADP-D-glucose}}
+
−
{{#set: consumed by=RXN-14378}}
+
−
{{#set: produced by=GLUC1PADENYLTRANS-RXN}}
+
−
{{#set: consumed or produced by=GLYCOGENSYN-RXN}}
+

Revision as of 16:56, 23 May 2018

Reaction RXN-14354

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Disproportionating Enzyme type 2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7238, sucrose biosynthesis II: PWY-7238
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-14354&oldid=18564"