Difference between revisions of "CPD-202"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.77-RXN 2.1.1.77-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] == * smiles: ** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J |
+ | * common name: | ||
+ | ** choloyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 1154.064 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA | ||
+ | ** 3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.3.1.176-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266600 45266600] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57373 57373] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01794 C01794] |
− | * | + | * HMDB : HMDB01374 |
− | + | {{#set: smiles=CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))}} | |
− | + | {{#set: inchi key=InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J}} | |
− | + | {{#set: common name=choloyl-CoA}} | |
− | + | {{#set: molecular weight=1154.064 }} | |
− | + | {{#set: common name=3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA}} | |
− | + | {{#set: produced by=2.3.1.176-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:57, 23 May 2018
Contents
Metabolite CPD-202
- smiles:
- CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))
- inchi key:
- InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J
- common name:
- choloyl-CoA
- molecular weight:
- 1154.064
- Synonym(s):
- 3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA
- 3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))" cannot be used as a page name in this wiki.