Difference between revisions of "RNA-DNA-hybrids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-DNA-hybrids RNA-DNA-hybrids] == * common name: ** a RNA-DNA hybrid * Synonym(s): == Reacti...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-DNA-hybrids RNA-DNA-hybrids] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
* inchi key:
+
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
+
 
* common name:
 
* common name:
** dihydrogeranylgeranyl chlorophyll a
+
** a RNA-DNA hybrid
* molecular weight:
+
** 888.463   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydrogeranylgeranyl-chl a
 
** dihydroGG-chl a
 
** dihydroGG-chlorophyll a
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7665]]
+
* [[3.1.26.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7664]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a RNA-DNA hybrid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
+
{{#set: consumed by=3.1.26.4-RXN}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
+
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
+
{{#set: molecular weight=888.463    }}
+
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
+
{{#set: consumed by=RXN-7665}}
+
{{#set: produced by=RXN-7664}}
+

Latest revision as of 16:58, 23 May 2018

Metabolite RNA-DNA-hybrids

  • common name:
    • a RNA-DNA hybrid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links