Difference between revisions of "1.14.13.79-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.79-RXN 1.14.13.79-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenoate mo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.79-RXN 1.14.13.79-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ent-kaurenoate monooxygenase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-132]][c] '''=>''' 1 [[CPD1F-136]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 oxygen[c] '''+''' 1 ent-kaur-16-en-19-oate[c] '''=>''' 1 ent-7α-hydroxykaur-16-en-19-oate[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009303001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] | ||
+ | ** '''6''' reactions found over '''15''' reactions in the full pathway | ||
+ | * [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19241 19241] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06294 R06294] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ent-kaurenoate monooxygenase}} | |
− | + | {{#set: gene associated=CHC_T00009303001_1}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY-5047|PWY-5034}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:59, 23 May 2018
Contents
Reaction 1.14.13.79-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ent-kaurenoate monooxygenase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 H+[c] + 1 oxygen[c] + 1 ent-kaur-16-en-19-oate[c] => 1 ent-7α-hydroxykaur-16-en-19-oate[c] + 1 NADP+[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009303001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
- 6 reactions found over 15 reactions in the full pathway
- PWY-5034, GA12 biosynthesis: PWY-5034
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links