Difference between revisions of "CHC T00009072001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
 
(Created page with "Category:Gene == Gene CHC_T00009072001 == * left end position: ** 85168 * transcription direction: ** POSITIVE * right end position: ** 85926 * centisome position: ** 33.7...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Gene CHC_T00009072001 ==
* smiles:
+
* left end position:
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
+
** 85168
* inchi key:
+
* transcription direction:
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
** POSITIVE
* common name:
+
* right end position:
** molybdopterin adenine dinucleotide
+
** 85926
* molecular weight:
+
* centisome position:
** 721.529    
+
** 33.732437    
 
* Synonym(s):
 
* Synonym(s):
** adenylated molybdopterin
 
** H2Dtpp-mADP
 
** molybdopterin-AMP
 
** adenylyl-molybdopterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-8348]]
+
* Reaction: [[RXN-3701]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
* [[RXN-8344]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=85168}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=85926}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
{{#set: centisome position=33.732437   }}
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
+
{{#set: reaction associated=RXN-3701}}
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: molecular weight=721.529   }}
+
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: consumed by=RXN-8348}}
+
{{#set: produced by=RXN-8344}}
+

Latest revision as of 17:59, 23 May 2018

Gene CHC_T00009072001

  • left end position:
    • 85168
  • transcription direction:
    • POSITIVE
  • right end position:
    • 85926
  • centisome position:
    • 33.732437
  • Synonym(s):

Reactions associated

Pathways associated

External links