Difference between revisions of "RXN-11917"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11917 RXN-11917] == * direction: ** LEFT-TO-RIGHT * common name: ** 7-methyl-3-oxo-6-octenoyl-C...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11917 RXN-11917] ==
−
* smiles:
+
* direction:
−
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
 
* common name:
 
* common name:
−
** (R)-S-lactoylglutathione
+
** 7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase
−
* molecular weight:
+
* ec number:
−
** 378.376   
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
 
* Synonym(s):
 
* Synonym(s):
−
** S-D-lactoylglutathione
+
** 7-methyl-3-oxo-6-octenoyl-CoA thiolase
−
** D-lactoylglutathione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GLYOXII-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-12897]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[CPD-12902]][c] '''+''' 1 [[ACETYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[GLYOXI-RXN]]
+
** 1 7-methyl-3-oxooct-6-enoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 5-methylhex-4-enoyl-CoA[c] '''+''' 1 acetyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009349001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
 +
** '''4''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25138-66-3
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R08091 R08091]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01066
+
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA thiolase}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00009349001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
{{#set: in pathway=PWY-6672}}
−
* BIGG : lgt__S
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
−
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(R)-S-lactoylglutathione}}
+
−
{{#set: molecular weight=378.376    }}
+
−
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
−
{{#set: consumed by=GLYOXII-RXN}}
+
−
{{#set: consumed or produced by=GLYOXI-RXN}}
+

Latest revision as of 17:00, 23 May 2018

Reaction RXN-11917

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 7-methyl-3-oxo-6-octenoyl-CoA:acetyl-CoA C-acyltransferase
  • ec number:
  • Synonym(s):
    • 7-methyl-3-oxo-6-octenoyl-CoA thiolase

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 7-methyl-3-oxooct-6-enoyl-CoA[c] + 1 coenzyme A[c] => 1 5-methylhex-4-enoyl-CoA[c] + 1 acetyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6672, cis-genanyl-CoA degradation: PWY-6672
    • 4 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-11917&oldid=18826"