Difference between revisions of "RXN-7607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7607 RXN-7607] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(=O)CS(=O)(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L
+
** [http://enzyme.expasy.org/EC/3.1.3.99 EC-3.1.3.99]
−
* common name:
+
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
−
** 3-sulfopyruvate
+
−
* molecular weight:
+
−
** 166.105   
+
 
* Synonym(s):
 
* Synonym(s):
−
** sulfopyruvate
 
−
** 3-Sulfopyruvic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[IMP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[INOSINE]][c] '''+''' 1 [[Pi]][c]
−
* [[RXN-11737]]
+
* With common name(s):
 +
** 1 IMP[c] '''+''' 1 H2O[c] '''=>''' 1 inosine[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008300001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000267001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05528 C05528]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27718 27718]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01126 R01126]
−
* METABOLIGHTS : MTBLC57940
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.3.99}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217]
+
{{#set: ec number=EC-3.1.3.5}}
−
* HMDB : HMDB04045
+
{{#set: gene associated=CHC_T00008300001_1|CHC_T00000267001_1}}
−
{{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}}
+
{{#set: in pathway=PWY-6596}}
−
{{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=3-sulfopyruvate}}
+
{{#set: reconstruction source=orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
−
{{#set: molecular weight=166.105    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}}
+
−
{{#set: consumed or produced by=RXN-11737}}
+

Revision as of 17:01, 23 May 2018

Reaction RXN-7607

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 IMP[c] + 1 H2O[c] => 1 inosine[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6596, adenosine nucleotides degradation I: PWY-6596
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-7607&oldid=18840"