Difference between revisions of "L-Cysteine-Desulfurase-persulfide"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] == * common name: ** an [L...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Cysteine-Desulfurase-persulfide L-Cysteine-Desulfurase-persulfide] ==
* smiles:
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
+
 
* common name:
 
* common name:
** 3-oxo-24-ethyl-cholest-5-ene
+
** an [L-cysteine desulfurase] L-cysteine persulfide
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14382]]
 +
* [[RXN-12473]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12789]]
+
* [[RXN0-308]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-12587]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [L-cysteine desulfurase] L-cysteine persulfide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
+
{{#set: consumed by=RXN-14382|RXN-12473}}
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: produced by=RXN0-308}}
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
+
{{#set: reversible reaction associated=RXN-12587}}
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: produced by=RXN-12789}}
+

Latest revision as of 17:01, 23 May 2018

Metabolite L-Cysteine-Desulfurase-persulfide

  • common name:
    • an [L-cysteine desulfurase] L-cysteine persulfide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [L-cysteine desulfurase] L-cysteine persulfide" cannot be used as a page name in this wiki.