Difference between revisions of "CPD-578"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-Serine N-terminal-L-Serine] == * common name: ** an N-terminal L-seryl-[protein] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] == * smiles: ** C(N)(NC([O-])=O)=O * inchi key: ** InChIKey=AVWRKZWQTYIKIY-UHF...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-578 CPD-578] == |
+ | * smiles: | ||
+ | ** C(N)(NC([O-])=O)=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=AVWRKZWQTYIKIY-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** urea-1-carboxylate |
+ | * molecular weight: | ||
+ | ** 103.057 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** allophanate |
+ | ** allophanic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALLOPHANATE-HYDROLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UREA-CARBOXYLASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543250 9543250] |
− | {{#set: consumed by= | + | * CHEMSPIDER: |
− | {{#set: produced by= | + | ** [http://www.chemspider.com/Chemical-Structure.7822223.html 7822223] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15832 15832] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01010 C01010] | ||
+ | {{#set: smiles=C(N)(NC([O-])=O)=O}} | ||
+ | {{#set: inchi key=InChIKey=AVWRKZWQTYIKIY-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=urea-1-carboxylate}} | ||
+ | {{#set: molecular weight=103.057 }} | ||
+ | {{#set: common name=allophanate|allophanic acid}} | ||
+ | {{#set: consumed by=ALLOPHANATE-HYDROLASE-RXN}} | ||
+ | {{#set: produced by=UREA-CARBOXYLASE-RXN}} |
Revision as of 17:02, 23 May 2018
Contents
Metabolite CPD-578
- smiles:
- C(N)(NC([O-])=O)=O
- inchi key:
- InChIKey=AVWRKZWQTYIKIY-UHFFFAOYSA-M
- common name:
- urea-1-carboxylate
- molecular weight:
- 103.057
- Synonym(s):
- allophanate
- allophanic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(N)(NC([O-])=O)=O" cannot be used as a page name in this wiki.