Difference between revisions of "CHC T00009287001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Gene == Gene CHC_T00009287001 == * left end position: ** 120917 * transcription direction: ** POSITIVE * right end position: ** 121558 * centisome position: ** 95...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009287001 == |
− | * | + | * left end position: |
− | ** | + | ** 120917 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 121558 |
− | * | + | * centisome position: |
− | ** | + | ** 95.841125 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GSHTRAN-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[GST-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-13673]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-15680]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=120917}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=121558}} | |
− | + | {{#set: centisome position=95.841125 }} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 17:02, 23 May 2018
Gene CHC_T00009287001
- left end position:
- 120917
- transcription direction:
- POSITIVE
- right end position:
- 121558
- centisome position:
- 95.841125
- Synonym(s):
Reactions associated
- Reaction: GSHTRAN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: GST-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-13673
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-15680
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome