Difference between revisions of "2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Dihydrouridines tRNA-Dihydrouridines] == * common name: ** a 5,6-dihydrouridine in tRNA *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP] == |
+ | * smiles: | ||
+ | ** CSCCC(C([O-])=COP([O-])(=O)[O-])=O | ||
+ | * molecular weight: | ||
+ | ** 239.159 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YIEMFVNCENFBSD-XQRVVYSFSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** 2-hydroxy-5-(methylthio)-3-oxopent-1-enyl 1-phosphate |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-phosphoryloxyl-2-hydroxy-3-keto-5-methylthiopentene |
+ | ** 2-hydroxy-3-keto-5-methylthio-1-phosphopentene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R83-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[R82-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50605 50605] |
− | {{#set: produced by= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229144 44229144] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15651 C15651] | ||
+ | {{#set: smiles=CSCCC(C([O-])=COP([O-])(=O)[O-])=O}} | ||
+ | {{#set: molecular weight=239.159 }} | ||
+ | {{#set: inchi key=InChIKey=YIEMFVNCENFBSD-XQRVVYSFSA-K}} | ||
+ | {{#set: common name=2-hydroxy-5-(methylthio)-3-oxopent-1-enyl 1-phosphate}} | ||
+ | {{#set: common name=1-phosphoryloxyl-2-hydroxy-3-keto-5-methylthiopentene|2-hydroxy-3-keto-5-methylthio-1-phosphopentene}} | ||
+ | {{#set: consumed by=R83-RXN}} | ||
+ | {{#set: produced by=R82-RXN}} |
Latest revision as of 15:55, 9 January 2019
Contents
Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP
- smiles:
- CSCCC(C([O-])=COP([O-])(=O)[O-])=O
- molecular weight:
- 239.159
- inchi key:
- InChIKey=YIEMFVNCENFBSD-XQRVVYSFSA-K
- common name:
- 2-hydroxy-5-(methylthio)-3-oxopent-1-enyl 1-phosphate
- Synonym(s):
- 1-phosphoryloxyl-2-hydroxy-3-keto-5-methylthiopentene
- 2-hydroxy-3-keto-5-methylthio-1-phosphopentene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCC(C([O-])=COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.