Difference between revisions of "CPD-8612"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
 +
* molecular weight:
 +
** 428.697   
 +
* inchi key:
 +
** InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
 
* common name:
 
* common name:
** (R)-acetoin biosynthesis II
+
** 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
 
* Synonym(s):
 
* Synonym(s):
** D-acetoin biosynthesis II
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN66-17]]
* [[ACETOLACTSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
* [[RXN66-16]]
* [http://metacyc.org/META/NEW-IMAGE?object=ACETOLACTATE-DECARBOXYLASE-RXN ACETOLACTATE-DECARBOXYLASE-RXN]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: common name=(R)-acetoin biosynthesis II}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87046 87046]
{{#set: common name=D-acetoin biosynthesis II}}
+
* PUBCHEM:
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263319 44263319]
{{#set: reaction not found=2}}
+
* HMDB : HMDB12168
{{#set: completion rate=50.0}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C}}
 +
{{#set: molecular weight=428.697    }}
 +
{{#set: inchi key=InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N}}
 +
{{#set: common name=4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: consumed by=RXN66-17}}
 +
{{#set: produced by=RXN66-16}}

Latest revision as of 15:58, 9 January 2019

Metabolite CPD-8612

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
  • molecular weight:
    • 428.697
  • inchi key:
    • InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
  • common name:
    • 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.