Difference between revisions of "CPD-85"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00002741001_1 == * Synonym(s): == Reactions associated == * MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN ** pantograph-galdieria.sulphurari...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00002741001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] ==
 +
* smiles:
 +
** CSCCC(C([O-])=CO)=O
 +
* molecular weight:
 +
** 161.195   
 +
* inchi key:
 +
** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
 +
* common name:
 +
** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
 
* Synonym(s):
 
* Synonym(s):
 +
** 1,2-dihydroxy-3-keto-5-methylthiopentene anion
 +
** 1,2-dihydroxy-3-keto-5-methylthiopentane
 +
** 1,2-dihydroxy-3-keto-5-methylthiopentene
 +
** acireductone
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[3.1.3.77-RXN]]
== Pathways associated ==
+
* [[R83-RXN]]
* [[PWY-7375]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-7375}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606]
 +
* HMDB : HMDB12134
 +
{{#set: smiles=CSCCC(C([O-])=CO)=O}}
 +
{{#set: molecular weight=161.195    }}
 +
{{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}}
 +
{{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}}
 +
{{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}}
 +
{{#set: produced by=3.1.3.77-RXN|R83-RXN}}

Latest revision as of 14:58, 9 January 2019

Metabolite CPD-85

  • smiles:
    • CSCCC(C([O-])=CO)=O
  • molecular weight:
    • 161.195
  • inchi key:
    • InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
  • common name:
    • 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
  • Synonym(s):
    • 1,2-dihydroxy-3-keto-5-methylthiopentene anion
    • 1,2-dihydroxy-3-keto-5-methylthiopentane
    • 1,2-dihydroxy-3-keto-5-methylthiopentene
    • acireductone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.