Difference between revisions of "CHC T00008651001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008651001 == |
− | * | + | * left end position: |
− | ** | + | ** 131954 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 133087 |
− | * | + | * centisome position: |
− | ** | + | ** 13.778607 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PHOSPHORIBULOKINASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
− | + | * [[PWY-5723]] | |
+ | * [[CALVIN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=131954}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=133087}} | |
− | + | {{#set: centisome position=13.778607 }} | |
− | + | {{#set: reaction associated=PHOSPHORIBULOKINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5723|CALVIN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:59, 9 January 2019
Gene CHC_T00008651001
- left end position:
- 131954
- transcription direction:
- NEGATIVE
- right end position:
- 133087
- centisome position:
- 13.778607
- Synonym(s):
Reactions associated
- Reaction: PHOSPHORIBULOKINASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome