Difference between revisions of "PWY-6012"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012 PWY-6012] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** acyl carrier protein metabolism |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
| + | ** [acp] metabolism | ||
| + | ** ACP metabolism | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[3. | + | '''1''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[3.1.4.14-RXN]] | |
| − | * [[ | + | ** 0 associated gene: |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=HOLO-ACP-SYNTH-RXN HOLO-ACP-SYNTH-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6012 PWY-6012] |
| − | + | {{#set: common name=acyl carrier protein metabolism}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=[acp] metabolism|ACP metabolism}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 14:59, 9 January 2019
Pathway PWY-6012
- common name:
- acyl carrier protein metabolism
- taxonomic range:
- Synonym(s):
- [acp] metabolism
- ACP metabolism
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- 3.1.4.14-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
"acp] metabolism" cannot be used as a page name in this wiki.
