Difference between revisions of "CHC 70"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_70 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** carA |
− | * | + | * left end position: |
− | ** | + | ** 8799 |
+ | * transcription direction: | ||
+ | ** POSITIVE | ||
+ | * right end position: | ||
+ | ** 9956 | ||
+ | * centisome position: | ||
+ | ** 4.8859987 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CARBPSYN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[GLUTAMIN-RXN]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-13202]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-14196]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16909]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-16910]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7400]] | ||
+ | * [[PWY-5686]] | ||
+ | * [[GLUTAMINDEG-PWY]] | ||
+ | * [[CITRULBIO-PWY]] | ||
+ | * [[PWY-7790]] | ||
+ | * [[PWY-4984]] | ||
+ | * [[PWY-5154]] | ||
+ | * [[PWY-7693]] | ||
+ | * [[ARGSYNBSUB-PWY]] | ||
+ | * [[ARGSYN-PWY]] | ||
+ | * [[PWY-7791]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=carA}} | |
− | + | {{#set: left end position=8799}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=9956}} | |
− | + | {{#set: centisome position=4.8859987 }} | |
− | + | {{#set: reaction associated=CARBPSYN-RXN|GLUTAMIN-RXN|RXN-13202|RXN-14196|RXN-16909|RXN-16910}} | |
− | + | {{#set: pathway associated=PWY-7400|PWY-5686|GLUTAMINDEG-PWY|CITRULBIO-PWY|PWY-7790|PWY-4984|PWY-5154|PWY-7693|ARGSYNBSUB-PWY|ARGSYN-PWY|PWY-7791}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:01, 9 January 2019
Gene CHC_70
- common name:
- carA
- left end position:
- 8799
- transcription direction:
- POSITIVE
- right end position:
- 9956
- centisome position:
- 4.8859987
- Synonym(s):
Reactions associated
- Reaction: CARBPSYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: GLUTAMIN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-13202
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-14196
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-16909
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-16910
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
Pathways associated
- PWY-7400
- PWY-5686
- GLUTAMINDEG-PWY
- CITRULBIO-PWY
- PWY-7790
- PWY-4984
- PWY-5154
- PWY-7693
- ARGSYNBSUB-PWY
- ARGSYN-PWY
- PWY-7791