Difference between revisions of "CPD0-1065"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_880 == * left end position: ** 135337 * transcription direction: ** POSITIVE * right end position: ** 135453 * common name: ** psbI * centisome p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_880 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
* left end position:
+
* smiles:
** 135337
+
** C(CC[N+]CCCCC[N+])[N+]
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 162.298   
* right end position:
+
* inchi key:
** 135453
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
 
* common name:
 
* common name:
** psbI
+
** aminopropylcadaverine
* centisome position:
+
** 75.15132   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** N-3-aminopropyl-1,5-diaminopentane
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PSII-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN0-5217]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-101]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=135337}}
+
* CHEBI:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
{{#set: right end position=135453}}
+
* PUBCHEM:
{{#set: common name=psbI}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
{{#set: centisome position=75.15132    }}
+
* LIGAND-CPD:
{{#set: reaction associated=PSII-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
{{#set: pathway associated=PWY-101}}
+
* HMDB : HMDB12189
 +
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
 +
{{#set: molecular weight=162.298    }}
 +
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
 +
{{#set: common name=aminopropylcadaverine}}
 +
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
 +
{{#set: produced by=RXN0-5217}}

Latest revision as of 15:01, 9 January 2019

Metabolite CPD0-1065

  • smiles:
    • C(CC[N+]CCCCC[N+])[N+]
  • molecular weight:
    • 162.298
  • inchi key:
    • InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
  • common name:
    • aminopropylcadaverine
  • Synonym(s):
    • N-3-aminopropyl-1,5-diaminopentane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.