Difference between revisions of "CPD-18776"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Plastoquinols Plastoquinols] == * common name: ** a plastoquinol * Synonym(s): ** PQ == Reacti...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == |
| + | * smiles: | ||
| + | ** COC1(C(=O)CC(CO)(O)CC(O)=1) | ||
| + | * molecular weight: | ||
| + | ** 188.18 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-4-deoxygadusol |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17366]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-17370]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=COC1(C(=O)CC(CO)(O)CC(O)=1)}} |
| − | {{#set: | + | {{#set: molecular weight=188.18 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N}} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=(R)-4-deoxygadusol}} |
| + | {{#set: produced by=RXN-17366}} | ||
| + | {{#set: reversible reaction associated=RXN-17370}} | ||
Latest revision as of 16:02, 9 January 2019
Contents
Metabolite CPD-18776
- smiles:
- COC1(C(=O)CC(CO)(O)CC(O)=1)
- molecular weight:
- 188.18
- inchi key:
- InChIKey=ZONRIYAALKITGT-MRVPVSSYSA-N
- common name:
- (R)-4-deoxygadusol
- Synonym(s):
