Difference between revisions of "CPD-15678"

From metabolic_network
Jump to: navigation, search
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3722 PWY-3722] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
+
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 943.749   
 +
* inchi key:
 +
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
 
* common name:
 
* common name:
** glycine betaine biosynthesis II (Gram-positive bacteria)
+
** 4-trans-3-oxo-undecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 4E-3-oxo-undecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-14793]]
* [[BADH-RXN]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6021 RXN-6021]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-1239}}
+
* PUBCHEM:
{{#set: common name=glycine betaine biosynthesis II (Gram-positive bacteria)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
{{#set: reaction found=1}}
+
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reaction not found=2}}
+
{{#set: molecular weight=943.749    }}
{{#set: completion rate=50.0}}
+
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
 +
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
 +
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14793}}

Latest revision as of 15:02, 9 January 2019

Metabolite CPD-15678

  • smiles:
    • CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 943.749
  • inchi key:
    • InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
  • common name:
    • 4-trans-3-oxo-undecenoyl-CoA
  • Synonym(s):
    • 4E-3-oxo-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.