Difference between revisions of "PWY-4984"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4984 PWY-4984] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** urea cycle |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Krebs ornithine cycle |
| + | ** Krebs-Henseleit cycle | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[ARGSUCCINLYA-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00004007001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[ARGSUCCINSYN-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00010073001]] | ||
| + | *** [[CHC_T00010073001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[ORNCARBAMTRANSFER-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00005123001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-13202]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[CHC_T00008596001_1]] | ||
| + | *** [[CHC_T00010056001_1]] | ||
| + | *** [[CHC_70]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ARGINASE-RXN ARGINASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=urea cycle}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=Krebs ornithine cycle|Krebs-Henseleit cycle}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=80.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:04, 9 January 2019
Pathway PWY-4984
- common name:
- urea cycle
- taxonomic range:
- Synonym(s):
- Krebs ornithine cycle
- Krebs-Henseleit cycle
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- ARGSUCCINLYA-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- ARGSUCCINSYN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- ORNCARBAMTRANSFER-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-13202
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
