Difference between revisions of "SALVADEHYPOX-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCO * inchi key: ** InChIKey=BOTWFXYS...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** adenosine nucleotides degradation II |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** purine ribonucleotide/ribonucleoside metabolism |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''5''' reactions in the full pathway |
− | * [[ | + | * [[ADENODEAMIN-RXN]] |
− | + | ** 1 associated gene(s): | |
− | == Reaction(s) | + | *** [[CHC_T00001501001_1]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[AMP-DEPHOSPHORYLATION-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008300001_1]] | ||
+ | *** [[CHC_T00000267001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN-7682]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00000194001_1]] | ||
+ | *** [[CHC_T00006932001_1]] | ||
+ | *** [[CHC_T00006216001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RXN0-901]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00006216001_1]] | ||
+ | *** [[CHC_T00006932001_1]] | ||
+ | *** [[CHC_T00000194001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=INOPHOSPHOR-RXN INOPHOSPHOR-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY] | |
− | ** [http:// | + | {{#set: common name=adenosine nucleotides degradation II}} |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=purine ribonucleotide/ribonucleoside metabolism}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=80.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:04, 9 January 2019
Pathway SALVADEHYPOX-PWY
- common name:
- adenosine nucleotides degradation II
- taxonomic range:
- Synonym(s):
- purine ribonucleotide/ribonucleoside metabolism
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- ADENODEAMIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- AMP-DEPHOSPHORYLATION-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-7682
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN0-901
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: