Difference between revisions of "RIBOSE-5P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8999 CPD-8999] == * smiles: ** CSCCC(=O)C(=O)COP([O-])(=O)[O-] * inchi key: ** InChIKey=HKE...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-5P RIBOSE-5P] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 5 | + | ** D-ribose 5-phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-ribose-5-phosphoric acid |
− | ** | + | ** ribose-5-phosphoric acid |
− | ** | + | ** ribose-5P |
− | ** | + | ** D-ribose-5-P |
− | ** | + | ** ribose-5-P |
− | ** | + | ** D-ribose 5'-phosphate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RIB5PISOM-RXN]] | ||
+ | * [[1TRANSKETO-RXN-CPD-19339/GAP//RIBOSE-5P/XYLULOSE-5-PHOSPHATE.46.]] | ||
+ | * [[1TRANSKETO-RXN]] | ||
+ | * [[PRPPSYN-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=D-ribose 5-phosphate}} | |
− | + | {{#set: common name=D-ribose-5-phosphoric acid|ribose-5-phosphoric acid|ribose-5P|D-ribose-5-P|ribose-5-P|D-ribose 5'-phosphate}} | |
− | + | {{#set: reversible reaction associated=RIB5PISOM-RXN|1TRANSKETO-RXN-CPD-19339/GAP//RIBOSE-5P/XYLULOSE-5-PHOSPHATE.46.|1TRANSKETO-RXN|PRPPSYN-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name=5 | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 15:05, 9 January 2019
Contents
Metabolite RIBOSE-5P
- common name:
- D-ribose 5-phosphate
- Synonym(s):
- D-ribose-5-phosphoric acid
- ribose-5-phosphoric acid
- ribose-5P
- D-ribose-5-P
- ribose-5-P
- D-ribose 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
- RIB5PISOM-RXN
- 1TRANSKETO-RXN-CPD-19339/GAP//RIBOSE-5P/XYLULOSE-5-PHOSPHATE.46.
- 1TRANSKETO-RXN
- PRPPSYN-RXN