Difference between revisions of "CPD-4618"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO | ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO | ||
| + | * molecular weight: | ||
| + | ** 381.388 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N | ** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N | ||
* common name: | * common name: | ||
** cis-zeatin-7-N-glucoside | ** cis-zeatin-7-N-glucoside | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 20: | Line 20: | ||
* HMDB : HMDB12201 | * HMDB : HMDB12201 | ||
{{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}} | {{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}} | ||
| + | {{#set: molecular weight=381.388 }} | ||
{{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}} | {{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}} | ||
{{#set: common name=cis-zeatin-7-N-glucoside}} | {{#set: common name=cis-zeatin-7-N-glucoside}} | ||
| − | |||
{{#set: produced by=RXN-4733}} | {{#set: produced by=RXN-4733}} | ||
Latest revision as of 15:08, 9 January 2019
Contents
Metabolite CPD-4618
- smiles:
- CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
- molecular weight:
- 381.388
- inchi key:
- InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
- common name:
- cis-zeatin-7-N-glucoside
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12201
