Difference between revisions of "CPD-4618"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == |
* smiles: | * smiles: | ||
− | ** CC | + | ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO |
+ | * molecular weight: | ||
+ | ** 381.388 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N |
* common name: | * common name: | ||
− | ** | + | ** cis-zeatin-7-N-glucoside |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-4733]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244153 25244153] |
− | + | * HMDB : HMDB12201 | |
− | + | {{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}} | |
− | + | {{#set: molecular weight=381.388 }} | |
− | + | {{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}} | |
− | * HMDB : | + | {{#set: common name=cis-zeatin-7-N-glucoside}} |
− | {{#set: smiles=CC | + | {{#set: produced by=RXN-4733}} |
− | + | ||
− | + | ||
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: produced by= | + |
Latest revision as of 15:08, 9 January 2019
Contents
Metabolite CPD-4618
- smiles:
- CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
- molecular weight:
- 381.388
- inchi key:
- InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
- common name:
- cis-zeatin-7-N-glucoside
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12201