Difference between revisions of "ENT-KAUR-16-EN-19-OL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TA...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656]
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* molecular weight:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** 288.472   
 +
* inchi key:
 +
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
 
* common name:
 
* common name:
−
** trehalose biosynthesis I
+
** ent-kaurenol
 
* Synonym(s):
 
* Synonym(s):
−
** trehalose biosynthesis
+
** ent-kaur-16-en-19-ol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
* [[RXN-5242]]
−
** [[TREHALOSEPHOSPHA-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[TREHALOSE6PSYN-RXN]]
+
* [[1.14.13.78-RXN]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* CHEBI:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRESYN-PWY TRESYN-PWY]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
−
{{#set: taxonomic range=TAX-6656}}
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
−
{{#set: taxonomic range=TAX-4751}}
+
* LIGAND-CPD:
−
{{#set: common name=trehalose biosynthesis I}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
−
{{#set: common name=trehalose biosynthesis}}
+
* HMDB : HMDB36727
−
{{#set: reaction found=2}}
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
−
{{#set: reaction not found=0}}
+
{{#set: molecular weight=288.472    }}
 +
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
 +
{{#set: common name=ent-kaurenol}}
 +
{{#set: common name=ent-kaur-16-en-19-ol}}
 +
{{#set: consumed by=RXN-5242}}
 +
{{#set: produced by=1.14.13.78-RXN}}

Latest revision as of 16:08, 9 January 2019

Metabolite ENT-KAUR-16-EN-19-OL

  • smiles:
    • C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
  • molecular weight:
    • 288.472
  • inchi key:
    • InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
  • common name:
    • ent-kaurenol
  • Synonym(s):
    • ent-kaur-16-en-19-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ENT-KAUR-16-EN-19-OL&oldid=19875"