Difference between revisions of "CHC T00000449001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] ==
+
== Gene CHC_T00000449001_1 ==
* smiles:
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
+
* inchi key:
+
** InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
+
* common name:
+
** ubiquinol-9
+
* molecular weight:
+
** 797.255   
+
 
* Synonym(s):
 
* Synonym(s):
** ubiquinol(9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3PGAREARR-RXN]]
* [[2.1.1.64-RXN]]
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[RXN-15509]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-15510]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-15511]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-15512]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-15513]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[GLYCOLYSIS]]
 +
* [[P124-PWY]]
 +
* [[PWY-6142]]
 +
* [[PWY-5484]]
 +
* [[PWY-1042]]
 +
* [[P122-PWY]]
 +
* [[PWY-7003]]
 +
* [[PWY-1622]]
 +
* [[PWY-6901]]
 +
* [[PWY-5723]]
 +
* [[PWY-7218]]
 +
* [[PWY-6405]]
 +
* [[PWY-2221]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-7124]]
 +
* [[PWY66-399]]
 +
* [[GLUCONEO-PWY]]
 +
* [[P341-PWY]]
 +
* [[PWY-6886]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=3PGAREARR-RXN|RXN-15509|RXN-15510|RXN-15511|RXN-15512|RXN-15513}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45281170 45281170]
+
{{#set: pathway associated=GLYCOLYSIS|P124-PWY|PWY-6142|PWY-5484|PWY-1042|P122-PWY|PWY-7003|PWY-1622|PWY-6901|PWY-5723|PWY-7218|PWY-6405|PWY-2221|ANAGLYCOLYSIS-PWY|PWY-7124|PWY66-399|GLUCONEO-PWY|P341-PWY|PWY-6886}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84424 84424]
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}}
+
{{#set: inchi key=InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N}}
+
{{#set: common name=ubiquinol-9}}
+
{{#set: molecular weight=797.255    }}
+
{{#set: common name=ubiquinol(9)}}
+
{{#set: produced by=2.1.1.64-RXN}}
+

Latest revision as of 15:08, 9 January 2019

Gene CHC_T00000449001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links