Difference between revisions of "COLANSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=COLANSYN-PWY COLANSYN-PWY] ==
* smiles:
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
+
 
* common name:
 
* common name:
** avenasterol
+
** colanic acid building blocks biosynthesis
* molecular weight:
+
* taxonomic range:
** 412.698   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-4209]]
+
'''5''' reactions found over '''11''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PWY-5659]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[PWY-7343]]
 +
** 0 associated gene:
 +
* [[PWY-7344]]
 +
** 0 associated gene:
 +
* [[PWY-7346]]
 +
** 0 associated gene:
 +
* [[UDPGLUCEPIM-RXN]]
 +
** 5 associated gene(s):
 +
*** [[CHC_T00007304001_1]]
 +
*** [[CHC_T00006828001_1]]
 +
*** [[CHC_T00009498001]]
 +
*** [[CHC_T00009498001_1]]
 +
*** [[CHC_T00006831001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-66 PWY-66]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=COLANSYN-PWY COLANSYN-PWY]
* LIGAND-CPD:
+
{{#set: common name=colanic acid building blocks biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
+
{{#set: taxonomic range=TAX-1224}}
* HMDB : HMDB06851
+
{{#set: reaction found=5}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: total reaction=11}}
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
+
{{#set: completion rate=45.0}}
{{#set: common name=avenasterol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: consumed by=RXN-4209}}
+

Latest revision as of 16:11, 9 January 2019

Pathway COLANSYN-PWY

  • common name:
    • colanic acid building blocks biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

5 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links