Difference between revisions of "ASPARTATE-DEG1-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-DEG1-PWY ASPARTATE-DEG1-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-aspartate degradation I |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | * [[ | + | * [[ASPAMINOTRANS-RXN]] |
| − | + | ** 8 associated gene(s): | |
| − | + | *** [[CHC_T00010017001]] | |
| − | * [[ | + | *** [[CHC_T00005085001_1]] |
| − | * [[ | + | *** [[CHC_T00008432001]] |
| + | *** [[CHC_T00006498001_1]] | ||
| + | *** [[CHC_T00009477001]] | ||
| + | *** [[CHC_T00003344001_1]] | ||
| + | *** [[CHC_T00009477001_1]] | ||
| + | *** [[CHC_T00010197001]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=L-aspartate degradation I}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:11, 9 January 2019
Pathway ASPARTATE-DEG1-PWY
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- ASPAMINOTRANS-RXN
- 8 associated gene(s):
- 4 reconstruction source(s) associated:
