Difference between revisions of "Reduced-2Fe-2S-Ferredoxins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a reduced [2Fe-2S] ferredoxin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.8.1.6-RXN]] |
| + | * [[RXN-14950]] | ||
| + | * [[RXN-14959]] | ||
| + | * [[RXN-14957]] | ||
| + | * [[RXN0-949]] | ||
| + | * [[RXN-17472]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a reduced [2Fe-2S] ferredoxin}} | |
| − | + | {{#set: consumed by=2.8.1.6-RXN|RXN-14950|RXN-14959|RXN-14957|RXN0-949|RXN-17472}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 16:11, 9 January 2019
Contents
Metabolite Reduced-2Fe-2S-Ferredoxins
- common name:
- a reduced [2Fe-2S] ferredoxin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a reduced [2Fe-2S] ferredoxin" cannot be used as a page name in this wiki.
