Difference between revisions of "FECOSTEROL"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005267001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] == |
+ | * smiles: | ||
+ | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34)))) | ||
+ | * molecular weight: | ||
+ | ** 398.671 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N | ||
+ | * common name: | ||
+ | ** fecosterol | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 24-methylene-5α-cholest-8-en-3β-ol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN3O-203]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17038 17038] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440371 440371] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04525 C04525] | ||
+ | * LIPID_MAPS : LMST01030095 | ||
+ | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}} | ||
+ | {{#set: molecular weight=398.671 }} | ||
+ | {{#set: inchi key=InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N}} | ||
+ | {{#set: common name=fecosterol}} | ||
+ | {{#set: common name=24-methylene-5α-cholest-8-en-3β-ol}} | ||
+ | {{#set: consumed by=RXN3O-203}} |
Latest revision as of 15:11, 9 January 2019
Contents
Metabolite FECOSTEROL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 398.671
- inchi key:
- InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N
- common name:
- fecosterol
- Synonym(s):
- 24-methylene-5α-cholest-8-en-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.