Difference between revisions of "FECOSTEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=2...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34)))) |
| + | * molecular weight: | ||
| + | ** 398.671 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N |
* common name: | * common name: | ||
| − | ** | + | ** fecosterol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 24-methylene-5α-cholest-8-en-3β-ol |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-203]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17038 17038] |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440371 440371] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04525 C04525] |
| − | * | + | * LIPID_MAPS : LMST01030095 |
| − | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}} | |
| − | + | {{#set: molecular weight=398.671 }} | |
| − | {{#set: smiles=C | + | {{#set: inchi key=InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N}} |
| − | {{#set: | + | {{#set: common name=fecosterol}} |
| − | {{#set: | + | {{#set: common name=24-methylene-5α-cholest-8-en-3β-ol}} |
| − | {{#set: | + | {{#set: consumed by=RXN3O-203}} |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed | + | |
Latest revision as of 15:11, 9 January 2019
Contents
Metabolite FECOSTEROL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 398.671
- inchi key:
- InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N
- common name:
- fecosterol
- Synonym(s):
- 24-methylene-5α-cholest-8-en-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
