Difference between revisions of "CPD-4573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008753001_1 == * Synonym(s): == Reactions associated == * 2.4.1.46-RXN ** pantograph-galdieria.sulphuraria * RXN-16027 ** p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008753001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
 +
* smiles:
 +
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 +
* molecular weight:
 +
** 440.708   
 +
* inchi key:
 +
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
 +
* common name:
 +
** 14-oxolanosterol
 
* Synonym(s):
 
* Synonym(s):
 +
** 14-oxo-lanosterol
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.4.1.46-RXN]]
+
* [[RXN66-305]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-16027]]
+
* [[RXN66-304]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-401]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=2.4.1.46-RXN|RXN-16027}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-401}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
 +
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
 +
{{#set: molecular weight=440.708    }}
 +
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
 +
{{#set: common name=14-oxolanosterol}}
 +
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-305}}
 +
{{#set: produced by=RXN66-304}}

Latest revision as of 16:14, 9 January 2019

Metabolite CPD-4573

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • molecular weight:
    • 440.708
  • inchi key:
    • InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
  • common name:
    • 14-oxolanosterol
  • Synonym(s):
    • 14-oxo-lanosterol
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.