Difference between revisions of "FAD"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00004261001_1 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** pantograph-a.taliana == Pathways associated == == Externa...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == |
| + | * smiles: | ||
| + | ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6)) | ||
| + | * molecular weight: | ||
| + | ** 782.533 | ||
| + | * inchi key: | ||
| + | ** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K | ||
| + | * common name: | ||
| + | ** FAD | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** flavin adenine dinucleotide oxidized | ||
| + | ** flavin adenine dinucleotide | ||
| + | ** flavitan | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[FADSYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| + | * [[RXN-14264]] | ||
== External links == | == External links == | ||
| − | {{#set: reaction associated= | + | * BIGG : fad |
| + | * CAS : 146-14-5 | ||
| + | * HMDB : HMDB01248 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035] | ||
| + | * Wikipedia : Flavin_adenine_dinucleotide | ||
| + | {{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}} | ||
| + | {{#set: molecular weight=782.533 }} | ||
| + | {{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}} | ||
| + | {{#set: common name=FAD}} | ||
| + | {{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}} | ||
| + | {{#set: produced by=FADSYN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-14264}} | ||
Latest revision as of 15:14, 9 January 2019
Contents
Metabolite FAD
- smiles:
- CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
- molecular weight:
- 782.533
- inchi key:
- InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
- common name:
- FAD
- Synonym(s):
- flavin adenine dinucleotide oxidized
- flavin adenine dinucleotide
- flavitan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : fad
- CAS : 146-14-5
- HMDB : HMDB01248
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
- Wikipedia : Flavin_adenine_dinucleotide
"CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))" cannot be used as a page name in this wiki.
