Difference between revisions of "PWY-5664"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tetrahydrobiopterin biosynthesis II |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
− | * [ | + | ** 1 associated gene(s): |
− | * [ | + | *** [[CHC_T00001932001_1]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.220-RXN 1.1.1.220-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8854 RXN-8854] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=tetrahydrobiopterin biosynthesis II}} | |
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 15:15, 9 January 2019
Pathway PWY-5664
- common name:
- tetrahydrobiopterin biosynthesis II
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: