Difference between revisions of "CPD-11938"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6366 PWY-6366] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11938 CPD-11938] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1) |
| + | * molecular weight: | ||
| + | ** 805.885 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A | ||
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate |
* Synonym(s): | * Synonym(s): | ||
| + | ** 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate | ||
| + | ** 1D-myo-inositol 1-diphosphate pentakisphosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10974]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74945 74945] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479488 45479488] |
| + | {{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | ||
| + | {{#set: molecular weight=805.885 }} | ||
| + | {{#set: inchi key=InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A}} | ||
| + | {{#set: common name=1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} | ||
| + | {{#set: common name=1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate}} | ||
| + | {{#set: produced by=RXN-10974}} | ||
Latest revision as of 15:16, 9 January 2019
Contents
Metabolite CPD-11938
- smiles:
- C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 805.885
- inchi key:
- InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A
- common name:
- 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- Synonym(s):
- 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate
- 1D-myo-inositol 1-diphosphate pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.
