Difference between revisions of "PWY-5994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == * smiles: ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=R...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] ==
* smiles:
+
** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
+
* inchi key:
+
** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
+
 
* common name:
 
* common name:
** 9(S)-HPOTE
+
** palmitate biosynthesis I (animals and fungi)
* molecular weight:
+
* taxonomic range:
** 309.425   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 
* Synonym(s):
 
* Synonym(s):
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
+
** palmitic acid biosynthesis
** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
+
** de novo lipogenesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''22''' reactions found over '''31''' reactions in the full pathway
* [[RXN-8497]]
+
* [[3.1.2.21-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[4.2.1.58-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009190001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[4.2.1.59-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[4.2.1.61-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9514]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9518]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9520]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9524]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9528]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008477001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008557001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9532]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9533]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9536]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9537]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9540]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9549]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9648]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9650]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9651]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9652]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001]]
 +
*** [[CHC_T00009465001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9653]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9654]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-9655]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9515 RXN-9515]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9521 RXN-9521]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9530 RXN-9530]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9534 RXN-9534]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9542 RXN-9542]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=palmitate biosynthesis I (animals and fungi)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426]
+
{{#set: taxonomic range=TAX-33154}}
* CHEBI:
+
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962]
+
{{#set: reaction found=22}}
* LIGAND-CPD:
+
{{#set: total reaction=31}}
** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321]
+
{{#set: completion rate=71.0}}
{{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}}
+
{{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}}
+
{{#set: common name=9(S)-HPOTE}}
+
{{#set: molecular weight=309.425    }}
+
{{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}}
+
{{#set: produced by=RXN-8497}}
+

Latest revision as of 16:16, 9 January 2019

Pathway PWY-5994

  • common name:
    • palmitate biosynthesis I (animals and fungi)
  • taxonomic range:
  • Synonym(s):
    • palmitic acid biosynthesis
    • de novo lipogenesis

Reaction(s) found

22 reactions found over 31 reactions in the full pathway

Reaction(s) not found

External links