Difference between revisions of "PWY-6855"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] == * smiles: ** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) * inchi key:...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** chitin degradation I (archaea) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** chitin degradation (archaea) |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[ | + | * [[3.2.1.14-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00004415001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12309 RXN-12309] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12543 RXN-12543] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12544 RXN-12544] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12545 RXN-12545] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=chitin degradation I (archaea)}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=chitin degradation (archaea)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=7}} |
| − | {{#set: | + | {{#set: completion rate=14.000000000000002}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:17, 9 January 2019
Pathway PWY-6855
- common name:
- chitin degradation I (archaea)
- taxonomic range:
- Synonym(s):
- chitin degradation (archaea)
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- 3.2.1.14-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- GLUCOSAMINE-6-P-DEAMIN-RXN
- N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN
- RXN-12309
- RXN-12543
- RXN-12544
- RXN-12545
