Difference between revisions of "PWY-5794"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5794 PWY-5794] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** malonate degradation I (biotin-independent) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-9728]] |
| − | * [ | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00008765001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9729 RXN-9729] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9730 RXN-9730] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=malonate degradation I (biotin-independent)}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 15:17, 9 January 2019
Pathway PWY-5794
- common name:
- malonate degradation I (biotin-independent)
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-9728
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
