Difference between revisions of "SULFO-CYSTEINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 200.204 |
| + | * inchi key: | ||
| + | ** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M | ||
| + | * common name: | ||
| + | ** S-sulfo-L-cysteine | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** S-sulfocysteine | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[SULFOCYS-RXN]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225] |
| − | * LIGAND- | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408] |
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824] |
| − | {{#set: | + | * HMDB : HMDB00731 |
| − | {{#set: | + | {{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}} |
| − | {{#set: | + | {{#set: molecular weight=200.204 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}} |
| − | {{#set: | + | {{#set: common name=S-sulfo-L-cysteine}} |
| + | {{#set: common name=S-sulfocysteine}} | ||
| + | {{#set: reversible reaction associated=SULFOCYS-RXN}} | ||
Latest revision as of 15:19, 9 January 2019
Contents
Metabolite SULFO-CYSTEINE
- smiles:
- C(C([N+])C(=O)[O-])SS([O-])(=O)=O
- molecular weight:
- 200.204
- inchi key:
- InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
- common name:
- S-sulfo-L-cysteine
- Synonym(s):
- S-sulfocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([N+])C(=O)[O-])SS([O-])(=O)=O" cannot be used as a page name in this wiki.
