Difference between revisions of "CPD-7087"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.99.1.3-RXN 4.99.1.3-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == |
− | * | + | * smiles: |
− | ** | + | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) |
− | * | + | * molecular weight: |
− | ** | + | ** 319.247 |
+ | * inchi key: | ||
+ | ** InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M | ||
+ | * common name: | ||
+ | ** (+)-dihydromyricetin | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (+)-ampelopsin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7784]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429] |
− | * LIGAND- | + | * METABOLIGHTS : MTBLC28429 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244375 25244375] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906] |
− | + | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}} | |
− | {{#set: | + | {{#set: molecular weight=319.247 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M}} |
− | {{#set: | + | {{#set: common name=(+)-dihydromyricetin}} |
+ | {{#set: common name=(+)-ampelopsin}} | ||
+ | {{#set: consumed by=RXN-7784}} |
Latest revision as of 15:20, 9 January 2019
Contents
Metabolite CPD-7087
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
- molecular weight:
- 319.247
- inchi key:
- InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
- common name:
- (+)-dihydromyricetin
- Synonym(s):
- (+)-ampelopsin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.