Difference between revisions of "PWY-6174"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] ==
* smiles:
+
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
* inchi key:
+
** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
+
 
* common name:
 
* common name:
** D-myo-inositol (1,3,4)-trisphosphate
+
** mevalonate pathway II (archaea)
* molecular weight:
+
* taxonomic range:
** 414.049   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
** Ins(1,3,4)P3
+
** isoprenoid pathway
** 1-D-myo-inositol (1,3,4)-trisphosphate
+
** MVA pathway
** inositol 1,3,4-trisphosphate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[2.7.1.139-RXN]]
+
'''7''' reactions found over '''7''' reactions in the full pathway
* [[RXN-10939]]
+
* [[1.1.1.34-RXN]]
* [[2.7.1.133-RXN]]
+
** 1 associated gene(s):
== Reaction(s) known to produce the compound ==
+
*** [[CHC_T00006657001_1]]
* [[RXN-8730]]
+
** 1 reconstruction source(s) associated:
== Reaction(s) of unknown directionality ==
+
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008981001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
*** [[CHC_T00008981001]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008149001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[IPPISOM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00001581001_1]]
 +
*** [[CHC_T00006126001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-10067]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-10068]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=mevalonate pathway II (archaea)}}
** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243]
+
{{#set: taxonomic range=TAX-2157}}
* CHEBI:
+
{{#set: common name=isoprenoid pathway|MVA pathway}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414]
+
{{#set: reaction found=7}}
* METABOLIGHTS : MTBLC58414
+
{{#set: total reaction=7}}
* PUBCHEM:
+
{{#set: completion rate=100.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948]
+
* HMDB : HMDB01143
+
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}}
+
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: molecular weight=414.049    }}
+
{{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}}
+
{{#set: consumed by=2.7.1.139-RXN|RXN-10939|2.7.1.133-RXN}}
+
{{#set: produced by=RXN-8730}}
+

Latest revision as of 15:20, 9 January 2019

Pathway PWY-6174

  • common name:
    • mevalonate pathway II (archaea)
  • taxonomic range:
  • Synonym(s):
    • isoprenoid pathway
    • MVA pathway

Reaction(s) found

7 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links