Difference between revisions of "CPD-9038"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18379 CPD-18379] == * smiles: ** CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] * inchi key: **...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9038 CPD-9038] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O) |
| + | * molecular weight: | ||
| + | ** 842.768 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F |
* common name: | * common name: | ||
| − | ** 1 | + | ** precorrin-1 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8675]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UROPORIIIMETHYLTRANSA-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58893 58893] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245954 25245954] |
| − | + | * LIGAND-CPD: | |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15527 C15527] |
| − | {{#set: | + | {{#set: smiles=CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)}} |
| − | {{#set: common name=1 | + | {{#set: molecular weight=842.768 }} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F}} |
| − | {{#set: produced by=RXN | + | {{#set: common name=precorrin-1}} |
| + | {{#set: consumed by=RXN-8675}} | ||
| + | {{#set: produced by=UROPORIIIMETHYLTRANSA-RXN}} | ||
Latest revision as of 15:21, 9 January 2019
Contents
Metabolite CPD-9038
- smiles:
- CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)
- molecular weight:
- 842.768
- inchi key:
- InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F
- common name:
- precorrin-1
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)" cannot be used as a page name in this wiki.
