Difference between revisions of "BILIVERDINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17024 RXN-17024] == * direction: ** LEFT-TO-RIGHT * common name: ** Lysophosphatidic acid acylt...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
| + | * molecular weight: | ||
| + | ** 580.639 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** biliverdin-IX-α |
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** dehydrobilirubin | ||
| + | ** uteroverdine | ||
| + | ** biliverdine | ||
| + | ** biliverdin | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[1.3.7.2-RXN]] |
| − | + | * [[1.3.7.4-RXN]] | |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991] | |
| − | + | * METABOLIGHTS : MTBLC57991 | |
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245769 25245769] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00500 C00500] |
| − | {{#set: | + | * HMDB : HMDB01008 |
| − | {{#set: | + | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} |
| − | {{#set: | + | {{#set: molecular weight=580.639 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L}} |
| − | {{#set: | + | {{#set: common name=biliverdin-IX-α}} |
| + | {{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin}} | ||
| + | {{#set: consumed by=1.3.7.2-RXN|1.3.7.4-RXN}} | ||
| + | {{#set: produced by=HEME-OXYGENASE-DECYCLIZING-RXN}} | ||
Latest revision as of 15:22, 9 January 2019
Contents
Metabolite BILIVERDINE
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- molecular weight:
- 580.639
- inchi key:
- InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L
- common name:
- biliverdin-IX-α
- Synonym(s):
- dehydrobilirubin
- uteroverdine
- biliverdine
- biliverdin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
