Difference between revisions of "NMNH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HX HX] == * smiles: ** [XH] * common name: ** HX * Synonym(s): == Reaction(s) known to consume...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HX HX] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] ==
 
* smiles:
 
* smiles:
** [XH]
+
** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
 +
* molecular weight:
 +
** 334.222   
 +
* inchi key:
 +
** InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
 
* common name:
 
* common name:
** HX
+
** reduced β-nicotinamide D-ribonucleotide
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotinamide mononucleotide (reduced)
 +
** NMNH
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GSHTRAN-RXN]]
+
* [[RXN0-4401]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=[XH]}}
+
* CHEBI:
{{#set: common name=HX}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90832 90832]
{{#set: produced by=GSHTRAN-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246098 25246098]
 +
{{#set: smiles=C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)}}
 +
{{#set: molecular weight=334.222    }}
 +
{{#set: inchi key=InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L}}
 +
{{#set: common name=reduced β-nicotinamide D-ribonucleotide}}
 +
{{#set: common name=nicotinamide mononucleotide (reduced)|NMNH}}
 +
{{#set: produced by=RXN0-4401}}

Latest revision as of 15:22, 9 January 2019

Metabolite NMNH

  • smiles:
    • C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
  • molecular weight:
    • 334.222
  • inchi key:
    • InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
  • common name:
    • reduced β-nicotinamide D-ribonucleotide
  • Synonym(s):
    • nicotinamide mononucleotide (reduced)
    • NMNH

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)" cannot be used as a page name in this wiki.