Difference between revisions of "NMNH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8991 RXN-8991] == * direction: ** REVERSIBLE * common name: ** 3-isopropylmalate dehydratase **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8991 RXN-8991] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
 +
* molecular weight:
 +
** 334.222   
 +
* inchi key:
 +
** InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
 
* common name:
 
* common name:
** 3-isopropylmalate dehydratase
+
** reduced β-nicotinamide D-ribonucleotide
** 3-isopropylmalate dehydratase small subunit
+
 
* Synonym(s):
 
* Synonym(s):
** (2R,3S)-3-isopropylmalate hydro-lyase
+
** nicotinamide mononucleotide (reduced)
** β-isopropylmalate dehydratase
+
** NMNH
** α-isopropylmalate isomerase
+
** 3-isopropylmalate hydro-lyase
+
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE]][c] '''<=>''' 1 [[CPD-9451]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN0-4401]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 (2R,3S)-3-isopropylmalate[c] '''<=>''' 1 2-isopropylmaleate[c] '''+''' 1 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00009087001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009087001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00009184001]]
+
** ORIGINAL_GENOME
+
***AUTOMATED-NAME-MATCH
+
* [[CHC_T00009184001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
** [[pantograph]]-[[a.taliana]]
+
== Pathways  ==
+
* [[LEUSYN-PWY]], L-leucine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=LEUSYN-PWY LEUSYN-PWY]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
+
* [[PWY-6871]], 3-methylbutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6871 PWY-6871]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* CHEBI:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10676 10676]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90832 90832]
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R04001 R04001]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246098 25246098]
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)}}
{{#set: common name=3-isopropylmalate dehydratase}}
+
{{#set: molecular weight=334.222    }}
{{#set: common name=3-isopropylmalate dehydratase small subunit}}
+
{{#set: inchi key=InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L}}
{{#set: common name=(2R,3S)-3-isopropylmalate hydro-lyase|&beta;-isopropylmalate dehydratase|&alpha;-isopropylmalate isomerase|3-isopropylmalate hydro-lyase}}
+
{{#set: common name=reduced &beta;-nicotinamide D-ribonucleotide}}
{{#set: gene associated=CHC_T00009087001|CHC_T00009087001_1|CHC_T00009184001|CHC_T00009184001_1}}
+
{{#set: common name=nicotinamide mononucleotide (reduced)|NMNH}}
{{#set: in pathway=LEUSYN-PWY|PWY-6871}}
+
{{#set: produced by=RXN0-4401}}
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 15:22, 9 January 2019

Metabolite NMNH

  • smiles:
    • C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
  • molecular weight:
    • 334.222
  • inchi key:
    • InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
  • common name:
    • reduced β-nicotinamide D-ribonucleotide
  • Synonym(s):
    • nicotinamide mononucleotide (reduced)
    • NMNH

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)" cannot be used as a page name in this wiki.